C28H42O3S — CID 24741694
(6S,9R)-9-methyl-6-[(2S)-1-phenylsulfanyl-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-yl]-1,4-dioxaspiro[4.5]decane (PubChem CID 24741694) has the molecular formula C28H42O3S and a molecular weight of 458.71 g/mol. Its IUPAC name is (6S,9R)-9-methyl-6-[(2S)-1-phenylsulfanyl-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-yl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | (6S,9R)-9-methyl-6-[(2S)-1-phenylsulfanyl-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-yl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 24741694 |
| Molecular Formula | C28H42O3S |
| Molecular Weight | 458.71 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | (6S,9R)-9-methyl-6-[(2S)-1-phenylsulfanyl-4-[(1R,2R,3R,4S)-1,3,4-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-yl]-1,4-dioxaspiro[4.5]decane |
| SMILES | C[C@@H]1CC[C@@H]([C@H](CC[C@@H]2[C@@H](C)[C@]3(C)CC[C@@]2(C)O3)CSc2ccccc2)C2(C1)OCCO2 |
| InChI | InChI=1S/C28H42O3S/c1-20-10-12-25(28(18-20)29-16-17-30-28)22(19-32-23-8-6-5-7-9-23)11-13-24-21(2)26(3)14-15-27(24,4)31-26/h5-9,20-22,24-25H,10-19H2,1-4H3/t20-,21-,22-,24-,25+,26+,27-/m1/s1 |
| InChIKey | TVVNXLHITOKTJX-JLTIEQHGSA-N |
| XLogP | 6.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.71 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |