C33H56O8Si — CID 24741892
[(1R,2R,3R,4S,8S,11S,13S,16S)-2-acetyloxy-16-hydroxy-6,6,11,15,18,18-hexamethyl-13-triethylsilyloxy-5,7-dioxatetracyclo[12.3.1.03,11.04,8]octadec-14-en-4-yl]methyl acetate (PubChem CID 24741892) has the molecular formula C33H56O8Si and a molecular weight of 608.89 g/mol. Its IUPAC name is [(1R,2R,3R,4S,8S,11S,13S,16S)-2-acetyloxy-16-hydroxy-6,6,11,15,18,18-hexamethyl-13-triethylsilyloxy-5,7-dioxatetracyclo[12.3.1.03,11.04,8]octadec-14-en-4-yl]methyl acetate.
| Compound Name | [(1R,2R,3R,4S,8S,11S,13S,16S)-2-acetyloxy-16-hydroxy-6,6,11,15,18,18-hexamethyl-13-triethylsilyloxy-5,7-dioxatetracyclo[12.3.1.03,11.04,8]octadec-14-en-4-yl]methyl acetate |
|---|---|
| PubChem CID | 24741892 |
| Molecular Formula | C33H56O8Si |
| Molecular Weight | 608.89 g/mol |
| Exact Mass | 608.37 |
| IUPAC Name | [(1R,2R,3R,4S,8S,11S,13S,16S)-2-acetyloxy-16-hydroxy-6,6,11,15,18,18-hexamethyl-13-triethylsilyloxy-5,7-dioxatetracyclo[12.3.1.03,11.04,8]octadec-14-en-4-yl]methyl acetate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@]2(C)CC[C@@H]3OC(C)(C)O[C@]3(COC(C)=O)[C@H]2[C@H](OC(C)=O)[C@@H]2C[C@H](O)C(C)=C1C2(C)C |
| InChI | InChI=1S/C33H56O8Si/c1-12-42(13-2,14-3)40-25-18-32(11)16-15-26-33(19-37-21(5)34,41-31(9,10)39-26)29(32)28(38-22(6)35)23-17-24(36)20(4)27(25)30(23,7)8/h23-26,28-29,36H,12-19H2,1-11H3/t23-,24-,25-,26-,28+,29-,32-,33-/m0/s1 |
| InChIKey | RZPZLOLYKZVMLW-GOHRQNHDSA-N |
| XLogP | 6.31 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.89 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|