C24H36O7 — CID 12016140
[(1R,2R,3R,4S,7R,10S,12S,15S)-12-acetyloxy-2,4-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] acetate (PubChem CID 12016140) has the molecular formula C24H36O7 and a molecular weight of 436.55 g/mol. Its IUPAC name is [(1R,2R,3R,4S,7R,10S,12S,15S)-12-acetyloxy-2,4-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] acetate.
| Compound Name | [(1R,2R,3R,4S,7R,10S,12S,15S)-12-acetyloxy-2,4-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] acetate |
|---|---|
| PubChem CID | 12016140 |
| Molecular Formula | C24H36O7 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | [(1R,2R,3R,4S,7R,10S,12S,15S)-12-acetyloxy-2,4-dihydroxy-10,14,17,17-tetramethyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-15-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H]2[C@@H](O)[C@H]3[C@@](C)(CC[C@H]4OC[C@]43O)C[C@H](OC(C)=O)C(=C1C)C2(C)C |
| InChI | InChI=1S/C24H36O7/c1-12-16(30-13(2)25)9-15-20(27)21-23(6,8-7-18-24(21,28)11-29-18)10-17(31-14(3)26)19(12)22(15,4)5/h15-18,20-21,27-28H,7-11H2,1-6H3/t15-,16-,17-,18+,20+,21-,23-,24-/m0/s1 |
| InChIKey | MUCJVVPXBGRMLP-CHKXTWCSSA-N |
| XLogP | 2.52 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|