C25H40O10S — CID 12016139
[(1R,2R,3R,4S,5S,8S,10S,13S)-10-acetyloxy-2,4-dihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-5-methylsulfonyloxy-13-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate (PubChem CID 12016139) has the molecular formula C25H40O10S and a molecular weight of 532.65 g/mol. Its IUPAC name is [(1R,2R,3R,4S,5S,8S,10S,13S)-10-acetyloxy-2,4-dihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-5-methylsulfonyloxy-13-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate.
| Compound Name | [(1R,2R,3R,4S,5S,8S,10S,13S)-10-acetyloxy-2,4-dihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-5-methylsulfonyloxy-13-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
|---|---|
| PubChem CID | 12016139 |
| Molecular Formula | C25H40O10S |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | [(1R,2R,3R,4S,5S,8S,10S,13S)-10-acetyloxy-2,4-dihydroxy-4-(hydroxymethyl)-8,12,15,15-tetramethyl-5-methylsulfonyloxy-13-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H]2[C@@H](O)[C@H]3[C@@](C)(CC[C@H](OS(C)(=O)=O)[C@@]3(O)CO)C[C@H](OC(C)=O)C(=C1C)C2(C)C |
| InChI | InChI=1S/C25H40O10S/c1-13-17(33-14(2)27)10-16-21(29)22-24(6,11-18(34-15(3)28)20(13)23(16,4)5)9-8-19(25(22,30)12-26)35-36(7,31)32/h16-19,21-22,26,29-30H,8-12H2,1-7H3/t16-,17-,18-,19-,21+,22-,24-,25-/m0/s1 |
| InChIKey | JJMKBNSGFAESKE-FJXVVUKBSA-N |
| XLogP | 1.46 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|