About chloropalladium(1+);diphenyl-[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]oxyphosphane
chloropalladium(1+);diphenyl-[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]oxyphosphane (PubChem CID 24745198) has the molecular formula C22H18ClN2OPPd
and a molecular weight of 499.25 g/mol. Its IUPAC name is chloropalladium(1+);diphenyl-[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]oxyphosphane.
Molecular Properties
| Compound Name | chloropalladium(1+);diphenyl-[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]oxyphosphane |
| PubChem CID | 24745198 |
| Molecular Formula | C22H18ClN2OPPd |
| Molecular Weight | 499.25 g/mol |
| Exact Mass | 497.99 |
| IUPAC Name | chloropalladium(1+);diphenyl-[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]oxyphosphane |
| SMILES | Cl[Pd+].[c-]1c(Cn2cccn2)cccc1OP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18N2OP.ClH.Pd/c1-3-11-21(12-4-1)26(22-13-5-2-6-14-22)25-20-10-7-9-19(17-20)18-24-16-8-15-23-24;;/h1-16H,18H2;1H;/q-1;;+2/p-1 |
| InChIKey | HVPSWBOXLLBEFW-UHFFFAOYSA-M |
| XLogP | 4.85 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.25 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloropalladium(1+);diphenyl-[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]oxyphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloropalladium(1+);diphenyl-[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]oxyphosphane?
The IUPAC name of chloropalladium(1+);diphenyl-[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]oxyphosphane (CID 24745198) is chloropalladium(1+);diphenyl-[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]oxyphosphane.
What is the SMILES notation for chloropalladium(1+);diphenyl-[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]oxyphosphane?
The canonical SMILES for chloropalladium(1+);diphenyl-[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]oxyphosphane is Cl[Pd+].[c-]1c(Cn2cccn2)cccc1OP(c1ccccc1)c1ccccc1.
What is the InChIKey of chloropalladium(1+);diphenyl-[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]oxyphosphane?
The InChIKey is HVPSWBOXLLBEFW-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H18N2OP.ClH.Pd/c1-3-11-21(12-4-1)26(22-13-5-2-6-14-22)25-20-10-7-9-19(17-20)18-24-16-8-15-23-24;;/h1-16H,18H2;1H;/q-1;;+2/p-1.
What are the key properties of chloropalladium(1+);diphenyl-[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]oxyphosphane?
chloropalladium(1+);diphenyl-[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]oxyphosphane has a molecular weight of 499.25 g/mol, XLogP of 4.85, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloropalladium(1+);diphenyl-[3-(pyrazol-1-ylmethyl)benzene-2-id-1-yl]oxyphosphane is sourced from PubChem (CID 24745198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).