C11H12O2S2 — CID 24751388
(1S,6R)-1-methyl-6-phenyl-7,8-dioxa-2,5-dithiabicyclo[4.2.0]octane (PubChem CID 24751388) has the molecular formula C11H12O2S2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (1S,6R)-1-methyl-6-phenyl-7,8-dioxa-2,5-dithiabicyclo[4.2.0]octane.
| Compound Name | (1S,6R)-1-methyl-6-phenyl-7,8-dioxa-2,5-dithiabicyclo[4.2.0]octane |
|---|---|
| PubChem CID | 24751388 |
| Molecular Formula | C11H12O2S2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | (1S,6R)-1-methyl-6-phenyl-7,8-dioxa-2,5-dithiabicyclo[4.2.0]octane |
| SMILES | C[C@@]12OO[C@]1(c1ccccc1)SCCS2 |
| InChI | InChI=1S/C11H12O2S2/c1-10-11(13-12-10,15-8-7-14-10)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3/t10-,11+/m0/s1 |
| InChIKey | SRHALGWZYYPLKY-WDEREUQCSA-N |
| XLogP | 3.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|