C10H11IOS — CID 129226100
2-iodo-2-phenyl-1,3-oxathiane (PubChem CID 129226100) has the molecular formula C10H11IOS and a molecular weight of 306.17 g/mol. Its IUPAC name is 2-iodo-2-phenyl-1,3-oxathiane.
| Compound Name | 2-iodo-2-phenyl-1,3-oxathiane |
|---|---|
| PubChem CID | 129226100 |
| Molecular Formula | C10H11IOS |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 2-iodo-2-phenyl-1,3-oxathiane |
| SMILES | IC1(c2ccccc2)OCCCS1 |
| InChI | InChI=1S/C10H11IOS/c11-10(12-7-4-8-13-10)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| InChIKey | XQFSODXKFTWFON-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|