C8H5Br2F3OS — CID 24756305
3,4-dibromo-1,1,1-trifluoro-4-thiophen-2-ylbutan-2-one (PubChem CID 24756305) has the molecular formula C8H5Br2F3OS and a molecular weight of 366.00 g/mol. Its IUPAC name is 3,4-dibromo-1,1,1-trifluoro-4-thiophen-2-ylbutan-2-one.
| Compound Name | 3,4-dibromo-1,1,1-trifluoro-4-thiophen-2-ylbutan-2-one |
|---|---|
| PubChem CID | 24756305 |
| Molecular Formula | C8H5Br2F3OS |
| Molecular Weight | 366.00 g/mol |
| Exact Mass | 363.84 |
| IUPAC Name | 3,4-dibromo-1,1,1-trifluoro-4-thiophen-2-ylbutan-2-one |
| SMILES | O=C(C(Br)C(Br)c1cccs1)C(F)(F)F |
| InChI | InChI=1S/C8H5Br2F3OS/c9-5(4-2-1-3-15-4)6(10)7(14)8(11,12)13/h1-3,5-6H |
| InChIKey | JODKKBBEQBKONZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.00 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|