C7H8F2N2O2S — CID 86748367
2,2-difluoro-3-hydroxy-3-thiophen-2-ylpropanehydrazide (PubChem CID 86748367) has the molecular formula C7H8F2N2O2S and a molecular weight of 222.22 g/mol. Its IUPAC name is 2,2-difluoro-3-hydroxy-3-thiophen-2-ylpropanehydrazide.
| Compound Name | 2,2-difluoro-3-hydroxy-3-thiophen-2-ylpropanehydrazide |
|---|---|
| PubChem CID | 86748367 |
| Molecular Formula | C7H8F2N2O2S |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 2,2-difluoro-3-hydroxy-3-thiophen-2-ylpropanehydrazide |
| SMILES | NNC(=O)C(F)(F)C(O)c1cccs1 |
| InChI | InChI=1S/C7H8F2N2O2S/c8-7(9,6(13)11-10)5(12)4-2-1-3-14-4/h1-3,5,12H,10H2,(H,11,13) |
| InChIKey | SOZIAPPMBPHHEG-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|