C16H10F3N3O4S — CID 24757069
[[7-hydroxy-2-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[4,5-c]pyridine-6-carbonyl]amino] acetate (PubChem CID 24757069) has the molecular formula C16H10F3N3O4S and a molecular weight of 397.33 g/mol. Its IUPAC name is [[7-hydroxy-2-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[4,5-c]pyridine-6-carbonyl]amino] acetate.
| Compound Name | [[7-hydroxy-2-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[4,5-c]pyridine-6-carbonyl]amino] acetate |
|---|---|
| PubChem CID | 24757069 |
| Molecular Formula | C16H10F3N3O4S |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | [[7-hydroxy-2-[4-(trifluoromethyl)phenyl]-[1,3]thiazolo[4,5-c]pyridine-6-carbonyl]amino] acetate |
| SMILES | CC(=O)ONC(=O)c1ncc2nc(-c3ccc(C(F)(F)F)cc3)sc2c1O |
| InChI | InChI=1S/C16H10F3N3O4S/c1-7(23)26-22-14(25)11-12(24)13-10(6-20-11)21-15(27-13)8-2-4-9(5-3-8)16(17,18)19/h2-6,24H,1H3,(H,22,25) |
| InChIKey | NSAAPNHYXPYSJH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|