C28H26F7NO4 — CID 24767852
3-methyl-1-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]butan-2-ol (PubChem CID 24767852) has the molecular formula C28H26F7NO4 and a molecular weight of 573.51 g/mol. Its IUPAC name is 3-methyl-1-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]butan-2-ol.
| Compound Name | 3-methyl-1-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]butan-2-ol |
|---|---|
| PubChem CID | 24767852 |
| Molecular Formula | C28H26F7NO4 |
| Molecular Weight | 573.51 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | 3-methyl-1-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]butan-2-ol |
| SMILES | CC(C)C(O)CN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2OCC1c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C28H26F7NO4/c1-16(2)24(37)14-36-22-11-5-10-21(17-6-3-9-20(12-17)40-28(33,34)35)25(22)38-15-23(36)18-7-4-8-19(13-18)39-27(31,32)26(29)30/h3-13,16,23-24,26,37H,14-15H2,1-2H3 |
| InChIKey | CNUCPBTXDKEBIW-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.51 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|