C26H19F10NO3S — CID 24767889
1,1,1-trifluoro-3-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzothiazin-4-yl]propan-2-ol (PubChem CID 24767889) has the molecular formula C26H19F10NO3S and a molecular weight of 615.49 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzothiazin-4-yl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzothiazin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 24767889 |
| Molecular Formula | C26H19F10NO3S |
| Molecular Weight | 615.49 g/mol |
| Exact Mass | 615.09 |
| IUPAC Name | 1,1,1-trifluoro-3-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzothiazin-4-yl]propan-2-ol |
| SMILES | OC(CN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2SCC1c1cccc(OC(F)(F)C(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C26H19F10NO3S/c27-23(28)25(32,33)39-16-6-2-5-15(11-16)20-13-41-22-18(14-4-1-7-17(10-14)40-26(34,35)36)8-3-9-19(22)37(20)12-21(38)24(29,30)31/h1-11,20-21,23,38H,12-13H2 |
| InChIKey | XWHHIJOFISUFOL-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.49 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|