C25H17F10NO3 — CID 88896133
(2S)-1,1,1-trifluoro-3-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-(3,4,5-trifluorophenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol (PubChem CID 88896133) has the molecular formula C25H17F10NO3 and a molecular weight of 569.40 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-3-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-(3,4,5-trifluorophenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-3-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-(3,4,5-trifluorophenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 88896133 |
| Molecular Formula | C25H17F10NO3 |
| Molecular Weight | 569.40 g/mol |
| Exact Mass | 569.10 |
| IUPAC Name | (2S)-1,1,1-trifluoro-3-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-(3,4,5-trifluorophenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
| SMILES | O[C@@H](CN1c2cccc(-c3cc(F)c(F)c(F)c3)c2OCC1c1cccc(OC(F)(F)C(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C25H17F10NO3/c26-16-8-13(9-17(27)21(16)28)15-5-2-6-18-22(15)38-11-19(36(18)10-20(37)24(31,32)33)12-3-1-4-14(7-12)39-25(34,35)23(29)30/h1-9,19-20,23,37H,10-11H2/t19?,20-/m0/s1 |
| InChIKey | WGVKEMILFKDYRY-ANYOKISRSA-N |
| XLogP | 6.87 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.40 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|