C24H18F9NO3 — CID 88901518
1,1,1-trifluoro-3-[(3S)-3-[3-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]-8-(3,4,5-trifluorophenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol (PubChem CID 88901518) has the molecular formula C24H18F9NO3 and a molecular weight of 539.39 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[(3S)-3-[3-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]-8-(3,4,5-trifluorophenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[(3S)-3-[3-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]-8-(3,4,5-trifluorophenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 88901518 |
| Molecular Formula | C24H18F9NO3 |
| Molecular Weight | 539.39 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | 1,1,1-trifluoro-3-[(3S)-3-[3-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]-8-(3,4,5-trifluorophenyl)-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
| SMILES | OC(CN1c2cccc(-c3cc(F)c(F)c(F)c3)c2OC[C@@H]1C1C=C(OC(F)(F)F)C=CC1)C(F)(F)F |
| InChI | InChI=1S/C24H18F9NO3/c25-16-8-13(9-17(26)21(16)27)15-5-2-6-18-22(15)36-11-19(34(18)10-20(35)23(28,29)30)12-3-1-4-14(7-12)37-24(31,32)33/h1-2,4-9,12,19-20,35H,3,10-11H2/t12?,19-,20?/m1/s1 |
| InChIKey | MWGCZMAAKWCDAR-JLDPNGGESA-N |
| XLogP | 6.26 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.39 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|