C56H45ClF12N2O7 — CID 159017478
2-chloro-1-phenylethanone;bis(1,1,1-trifluoro-3-[3-phenyl-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol) (PubChem CID 159017478) has the molecular formula C56H45ClF12N2O7 and a molecular weight of 1121.41 g/mol. Its IUPAC name is 2-chloro-1-phenylethanone;bis(1,1,1-trifluoro-3-[3-phenyl-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol).
| Compound Name | 2-chloro-1-phenylethanone;bis(1,1,1-trifluoro-3-[3-phenyl-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol) |
|---|---|
| PubChem CID | 159017478 |
| Molecular Formula | C56H45ClF12N2O7 |
| Molecular Weight | 1121.41 g/mol |
| Exact Mass | 1120.27 |
| IUPAC Name | 2-chloro-1-phenylethanone;bis(1,1,1-trifluoro-3-[3-phenyl-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol) |
| SMILES | O=C(CCl)c1ccccc1.OC(CN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2OCC1c1ccccc1)C(F)(F)F.OC(CN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2OCC1c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/2C24H19F6NO3.C8H7ClO/c2*25-23(26,27)21(32)13-31-19-11-5-10-18(16-8-4-9-17(12-16)34-24(28,29)30)22(19)33-14-20(31)15-6-2-1-3-7-15;9-6-8(10)7-4-2-1-3-5-7/h2*1-12,20-21,32H,13-14H2;1-5H,6H2 |
| InChIKey | JTGSSOLOWVYAOB-UHFFFAOYSA-N |
| XLogP | 14.34 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1121.41 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|