C26H23F7N2O5S — CID 24767850
N-[2-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]methanesulfonamide (PubChem CID 24767850) has the molecular formula C26H23F7N2O5S and a molecular weight of 608.53 g/mol. Its IUPAC name is N-[2-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 24767850 |
| Molecular Formula | C26H23F7N2O5S |
| Molecular Weight | 608.53 g/mol |
| Exact Mass | 608.12 |
| IUPAC Name | N-[2-[3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2OCC1c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C26H23F7N2O5S/c1-41(36,37)34-11-12-35-21-10-4-9-20(16-5-2-8-19(13-16)40-26(31,32)33)23(21)38-15-22(35)17-6-3-7-18(14-17)39-25(29,30)24(27)28/h2-10,13-14,22,24,34H,11-12,15H2,1H3 |
| InChIKey | WXNZYGQJBZHUEQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.53 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|