C26H24F7NO5 — CID 89319502
(2S)-3-[(3S)-3-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-2,4-dien-1-yl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propane-1,2-diol (PubChem CID 89319502) has the molecular formula C26H24F7NO5 and a molecular weight of 563.47 g/mol. Its IUPAC name is (2S)-3-[(3S)-3-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-2,4-dien-1-yl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propane-1,2-diol.
| Compound Name | (2S)-3-[(3S)-3-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-2,4-dien-1-yl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 89319502 |
| Molecular Formula | C26H24F7NO5 |
| Molecular Weight | 563.47 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | (2S)-3-[(3S)-3-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-2,4-dien-1-yl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propane-1,2-diol |
| SMILES | OC[C@@H](O)CN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2OC[C@@H]1C1C=C(OC(F)(F)C(F)F)C=CC1 |
| InChI | InChI=1S/C26H24F7NO5/c27-24(28)25(29,30)38-18-6-2-5-16(11-18)22-14-37-23-20(8-3-9-21(23)34(22)12-17(36)13-35)15-4-1-7-19(10-15)39-26(31,32)33/h1-4,6-11,16-17,22,24,35-36H,5,12-14H2/t16?,17-,22+/m0/s1 |
| InChIKey | ZCOJWJWOCKENHP-QUUZRVDCSA-N |
| XLogP | 5.51 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|