C27H24F7NO4 — CID 24767846
4-(3-methoxypropyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine (PubChem CID 24767846) has the molecular formula C27H24F7NO4 and a molecular weight of 559.48 g/mol. Its IUPAC name is 4-(3-methoxypropyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-(3-methoxypropyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 24767846 |
| Molecular Formula | C27H24F7NO4 |
| Molecular Weight | 559.48 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 4-(3-methoxypropyl)-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazine |
| SMILES | COCCCN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2OCC1c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C27H24F7NO4/c1-36-13-5-12-35-22-11-4-10-21(17-6-2-9-20(14-17)39-27(32,33)34)24(22)37-16-23(35)18-7-3-8-19(15-18)38-26(30,31)25(28)29/h2-4,6-11,14-15,23,25H,5,12-13,16H2,1H3 |
| InChIKey | WHUQRCCYOULZKF-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.48 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|