C26H23F6NO2 — CID 143710713
(2R)-1-propyl-2,5-bis[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinoline (PubChem CID 143710713) has the molecular formula C26H23F6NO2 and a molecular weight of 495.46 g/mol. Its IUPAC name is (2R)-1-propyl-2,5-bis[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinoline.
| Compound Name | (2R)-1-propyl-2,5-bis[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 143710713 |
| Molecular Formula | C26H23F6NO2 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | (2R)-1-propyl-2,5-bis[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinoline |
| SMILES | CCCN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2CC[C@@H]1c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C26H23F6NO2/c1-2-14-33-23(18-7-4-9-20(16-18)35-26(30,31)32)13-12-22-21(10-5-11-24(22)33)17-6-3-8-19(15-17)34-25(27,28)29/h3-11,15-16,23H,2,12-14H2,1H3/t23-/m1/s1 |
| InChIKey | PDLFNZRZUMBPMK-HSZRJFAPSA-N |
| XLogP | 8.05 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |