C27H24BrF6NO3 — CID 143710657
1-[2,5-bis[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]-2-bromoethanone;ethane (PubChem CID 143710657) has the molecular formula C27H24BrF6NO3 and a molecular weight of 604.39 g/mol. Its IUPAC name is 1-[2,5-bis[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]-2-bromoethanone;ethane.
| Compound Name | 1-[2,5-bis[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]-2-bromoethanone;ethane |
|---|---|
| PubChem CID | 143710657 |
| Molecular Formula | C27H24BrF6NO3 |
| Molecular Weight | 604.39 g/mol |
| Exact Mass | 603.08 |
| IUPAC Name | 1-[2,5-bis[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]-2-bromoethanone;ethane |
| SMILES | CC.O=C(CBr)N1c2cccc(-c3cccc(OC(F)(F)F)c3)c2CCC1c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C25H18BrF6NO3.C2H6/c26-14-23(34)33-21(16-5-2-7-18(13-16)36-25(30,31)32)11-10-20-19(8-3-9-22(20)33)15-4-1-6-17(12-15)35-24(27,28)29;1-2/h1-9,12-13,21H,10-11,14H2;1-2H3 |
| InChIKey | IBXHRNOXDJUOFD-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.39 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|