C18H16BrF4NO — CID 59009890
(2S)-5-bromo-1-methyl-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydro-2H-quinoline (PubChem CID 59009890) has the molecular formula C18H16BrF4NO and a molecular weight of 418.23 g/mol. Its IUPAC name is (2S)-5-bromo-1-methyl-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydro-2H-quinoline.
| Compound Name | (2S)-5-bromo-1-methyl-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 59009890 |
| Molecular Formula | C18H16BrF4NO |
| Molecular Weight | 418.23 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | (2S)-5-bromo-1-methyl-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-3,4-dihydro-2H-quinoline |
| SMILES | CN1c2cccc(Br)c2CC[C@H]1c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C18H16BrF4NO/c1-24-15(9-8-13-14(19)6-3-7-16(13)24)11-4-2-5-12(10-11)25-18(22,23)17(20)21/h2-7,10,15,17H,8-9H2,1H3/t15-/m0/s1 |
| InChIKey | SIACYLKSEJFIPE-HNNXBMFYSA-N |
| XLogP | 5.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.23 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|