C23H23F4NOS — CID 143710731
ethane;2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-thiophen-2-yl-1,2,3,4-tetrahydroquinoline (PubChem CID 143710731) has the molecular formula C23H23F4NOS and a molecular weight of 437.50 g/mol. Its IUPAC name is ethane;2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-thiophen-2-yl-1,2,3,4-tetrahydroquinoline.
| Compound Name | ethane;2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-thiophen-2-yl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 143710731 |
| Molecular Formula | C23H23F4NOS |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | ethane;2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-thiophen-2-yl-1,2,3,4-tetrahydroquinoline |
| SMILES | CC.FC(F)C(F)(F)Oc1cccc(C2CCc3c(cccc3-c3cccs3)N2)c1 |
| InChI | InChI=1S/C21H17F4NOS.C2H6/c22-20(23)21(24,25)27-14-5-1-4-13(12-14)17-10-9-15-16(19-8-3-11-28-19)6-2-7-18(15)26-17;1-2/h1-8,11-12,17,20,26H,9-10H2;1-2H3 |
| InChIKey | UJZWVWCXDZIKON-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|