C21H17F4NOS — CID 59009816
2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-thiophen-2-yl-1,2,3,4-tetrahydroquinoline (PubChem CID 59009816) has the molecular formula C21H17F4NOS and a molecular weight of 407.43 g/mol. Its IUPAC name is 2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-thiophen-2-yl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-thiophen-2-yl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 59009816 |
| Molecular Formula | C21H17F4NOS |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-thiophen-2-yl-1,2,3,4-tetrahydroquinoline |
| SMILES | FC(F)C(F)(F)Oc1cccc(C2CCc3c(cccc3-c3cccs3)N2)c1 |
| InChI | InChI=1S/C21H17F4NOS/c22-20(23)21(24,25)27-14-5-1-4-13(12-14)17-10-9-15-16(19-8-3-11-28-19)6-2-7-18(15)26-17/h1-8,11-12,17,20,26H,9-10H2 |
| InChIKey | LGQAFRJMEQZIEG-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|