C18H15BrF4O — CID 59009841
(2S)-5-bromo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 59009841) has the molecular formula C18H15BrF4O and a molecular weight of 403.21 g/mol. Its IUPAC name is (2S)-5-bromo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (2S)-5-bromo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 59009841 |
| Molecular Formula | C18H15BrF4O |
| Molecular Weight | 403.21 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | (2S)-5-bromo-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | FC(F)C(F)(F)Oc1cccc([C@H]2CCc3c(Br)cccc3C2)c1 |
| InChI | InChI=1S/C18H15BrF4O/c19-16-6-2-4-13-9-12(7-8-15(13)16)11-3-1-5-14(10-11)24-18(22,23)17(20)21/h1-6,10,12,17H,7-9H2/t12-/m0/s1 |
| InChIKey | YVBQFXRQFUVLLH-LBPRGKRZSA-N |
| XLogP | 5.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.21 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|