C27H24F7NO2 — CID 143710700
(2R)-1-propyl-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinoline (PubChem CID 143710700) has the molecular formula C27H24F7NO2 and a molecular weight of 527.48 g/mol. Its IUPAC name is (2R)-1-propyl-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinoline.
| Compound Name | (2R)-1-propyl-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 143710700 |
| Molecular Formula | C27H24F7NO2 |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | (2R)-1-propyl-2-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]-5-[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinoline |
| SMILES | CCCN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2CC[C@@H]1c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C27H24F7NO2/c1-2-14-35-23(18-7-4-8-19(16-18)36-26(30,31)25(28)29)13-12-22-21(10-5-11-24(22)35)17-6-3-9-20(15-17)37-27(32,33)34/h3-11,15-16,23,25H,2,12-14H2,1H3/t23-/m1/s1 |
| InChIKey | KDKFIRBGDBNXKH-HSZRJFAPSA-N |
| XLogP | 8.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|