C27H23F10NO2 — CID 89321225
(2R)-2-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-2,4-dien-1-yl]-5-[3-(trifluoromethoxy)phenyl]-1-(3,3,3-trifluoropropyl)-3,4-dihydro-2H-quinoline (PubChem CID 89321225) has the molecular formula C27H23F10NO2 and a molecular weight of 583.47 g/mol. Its IUPAC name is (2R)-2-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-2,4-dien-1-yl]-5-[3-(trifluoromethoxy)phenyl]-1-(3,3,3-trifluoropropyl)-3,4-dihydro-2H-quinoline.
| Compound Name | (2R)-2-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-2,4-dien-1-yl]-5-[3-(trifluoromethoxy)phenyl]-1-(3,3,3-trifluoropropyl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 89321225 |
| Molecular Formula | C27H23F10NO2 |
| Molecular Weight | 583.47 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | (2R)-2-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-2,4-dien-1-yl]-5-[3-(trifluoromethoxy)phenyl]-1-(3,3,3-trifluoropropyl)-3,4-dihydro-2H-quinoline |
| SMILES | FC(F)C(F)(F)OC1=CC([C@H]2CCc3c(-c4cccc(OC(F)(F)F)c4)cccc3N2CCC(F)(F)F)CC=C1 |
| InChI | InChI=1S/C27H23F10NO2/c28-24(29)26(33,34)39-18-6-2-5-17(15-18)22-11-10-21-20(16-4-1-7-19(14-16)40-27(35,36)37)8-3-9-23(21)38(22)13-12-25(30,31)32/h1-4,6-9,14-15,17,22,24H,5,10-13H2/t17?,22-/m1/s1 |
| InChIKey | CCUSKQLNBSQKRX-IVAFLUGOSA-N |
| XLogP | 8.66 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.47 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|