C27H23F10NO3 — CID 89321291
(2R)-1,1,1-trifluoro-3-[(2R)-2-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-2,4-dien-1-yl]-5-[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol (PubChem CID 89321291) has the molecular formula C27H23F10NO3 and a molecular weight of 599.47 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-[(2R)-2-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-2,4-dien-1-yl]-5-[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-[(2R)-2-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-2,4-dien-1-yl]-5-[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 89321291 |
| Molecular Formula | C27H23F10NO3 |
| Molecular Weight | 599.47 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-[(2R)-2-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexa-2,4-dien-1-yl]-5-[3-(trifluoromethoxy)phenyl]-3,4-dihydro-2H-quinolin-1-yl]propan-2-ol |
| SMILES | O[C@H](CN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2CC[C@@H]1C1C=C(OC(F)(F)C(F)F)C=CC1)C(F)(F)F |
| InChI | InChI=1S/C27H23F10NO3/c28-24(29)26(33,34)40-17-6-2-5-16(13-17)21-11-10-20-19(15-4-1-7-18(12-15)41-27(35,36)37)8-3-9-22(20)38(21)14-23(39)25(30,31)32/h1-4,6-9,12-13,16,21,23-24,39H,5,10-11,14H2/t16?,21-,23-/m1/s1 |
| InChIKey | BHEMOUJGQQBPJI-KDTADFBSSA-N |
| XLogP | 7.63 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.47 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|