C25H20F9NO4 — CID 89319584
(2S)-1,1,1-trifluoro-3-[(3S)-3-[3-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol (PubChem CID 89319584) has the molecular formula C25H20F9NO4 and a molecular weight of 569.42 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-3-[(3S)-3-[3-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-3-[(3S)-3-[3-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 89319584 |
| Molecular Formula | C25H20F9NO4 |
| Molecular Weight | 569.42 g/mol |
| Exact Mass | 569.12 |
| IUPAC Name | (2S)-1,1,1-trifluoro-3-[(3S)-3-[3-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]-8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
| SMILES | O[C@@H](CN1c2cccc(-c3cccc(OC(F)(F)F)c3)c2OC[C@@H]1C1C=C(OC(F)(F)F)C=CC1)C(F)(F)F |
| InChI | InChI=1S/C25H20F9NO4/c26-23(27,28)21(36)12-35-19-9-3-8-18(14-4-1-6-16(10-14)38-24(29,30)31)22(19)37-13-20(35)15-5-2-7-17(11-15)39-25(32,33)34/h1-4,6-11,15,20-21,36H,5,12-13H2/t15?,20-,21+/m1/s1 |
| InChIKey | SMSUVVXPNLHHFW-CGDWMNPFSA-N |
| XLogP | 6.74 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.42 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |