C26H21F10NO4 — CID 143581615
1,1,2,2-tetrafluoroethoxybenzene;1,1,1-trifluoro-3-[8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol (PubChem CID 143581615) has the molecular formula C26H21F10NO4 and a molecular weight of 601.44 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoroethoxybenzene;1,1,1-trifluoro-3-[8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol.
| Compound Name | 1,1,2,2-tetrafluoroethoxybenzene;1,1,1-trifluoro-3-[8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 143581615 |
| Molecular Formula | C26H21F10NO4 |
| Molecular Weight | 601.44 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | 1,1,2,2-tetrafluoroethoxybenzene;1,1,1-trifluoro-3-[8-[3-(trifluoromethoxy)phenyl]-2,3-dihydro-1,4-benzoxazin-4-yl]propan-2-ol |
| SMILES | FC(F)C(F)(F)Oc1ccccc1.OC(CN1CCOc2c(-c3cccc(OC(F)(F)F)c3)cccc21)C(F)(F)F |
| InChI | InChI=1S/C18H15F6NO3.C8H6F4O/c19-17(20,21)15(26)10-25-7-8-27-16-13(5-2-6-14(16)25)11-3-1-4-12(9-11)28-18(22,23)24;9-7(10)8(11,12)13-6-4-2-1-3-5-6/h1-6,9,15,26H,7-8,10H2;1-5,7H |
| InChIKey | RPYHXRLWMWWPHM-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.44 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|