C22H25N2O6S- — CID 24767916
5-[[1-(4-tert-butyl-2-nitrophenyl)-6-oxopiperidin-2-yl]methoxymethyl]thiophene-2-carboxylate (PubChem CID 24767916) has the molecular formula C22H25N2O6S- and a molecular weight of 445.52 g/mol. Its IUPAC name is 5-[[1-(4-tert-butyl-2-nitrophenyl)-6-oxopiperidin-2-yl]methoxymethyl]thiophene-2-carboxylate.
| Compound Name | 5-[[1-(4-tert-butyl-2-nitrophenyl)-6-oxopiperidin-2-yl]methoxymethyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 24767916 |
| Molecular Formula | C22H25N2O6S- |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 5-[[1-(4-tert-butyl-2-nitrophenyl)-6-oxopiperidin-2-yl]methoxymethyl]thiophene-2-carboxylate |
| SMILES | CC(C)(C)c1ccc(N2C(=O)CCCC2COCc2ccc(C(=O)[O-])s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H26N2O6S/c1-22(2,3)14-7-9-17(18(11-14)24(28)29)23-15(5-4-6-20(23)25)12-30-13-16-8-10-19(31-16)21(26)27/h7-11,15H,4-6,12-13H2,1-3H3,(H,26,27)/p-1 |
| InChIKey | AREJOALEXJNNNB-UHFFFAOYSA-M |
| XLogP | 3.42 |
| TPSA | 112.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|