C30H23ClINO2 — CID 24774092
10-(4-chlorophenyl)-5-(4-iodophenyl)-7,7-dimethyl-8,10-dihydro-6H-indeno[1,2-b]quinoline-9,11-dione (PubChem CID 24774092) has the molecular formula C30H23ClINO2 and a molecular weight of 591.88 g/mol. Its IUPAC name is 10-(4-chlorophenyl)-5-(4-iodophenyl)-7,7-dimethyl-8,10-dihydro-6H-indeno[1,2-b]quinoline-9,11-dione.
| Compound Name | 10-(4-chlorophenyl)-5-(4-iodophenyl)-7,7-dimethyl-8,10-dihydro-6H-indeno[1,2-b]quinoline-9,11-dione |
|---|---|
| PubChem CID | 24774092 |
| Molecular Formula | C30H23ClINO2 |
| Molecular Weight | 591.88 g/mol |
| Exact Mass | 591.05 |
| IUPAC Name | 10-(4-chlorophenyl)-5-(4-iodophenyl)-7,7-dimethyl-8,10-dihydro-6H-indeno[1,2-b]quinoline-9,11-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1ccc(I)cc1)C1=C(C(=O)c3ccccc31)C2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H23ClINO2/c1-30(2)15-23-26(24(34)16-30)25(17-7-9-18(31)10-8-17)27-28(21-5-3-4-6-22(21)29(27)35)33(23)20-13-11-19(32)12-14-20/h3-14,25H,15-16H2,1-2H3 |
| InChIKey | FICNACPLNOCIED-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.88 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|