C28H24N2O — CID 24778330
9-tert-butyl-2-(2-phenylethynyl)-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one (PubChem CID 24778330) has the molecular formula C28H24N2O and a molecular weight of 404.51 g/mol. Its IUPAC name is 9-tert-butyl-2-(2-phenylethynyl)-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one.
| Compound Name | 9-tert-butyl-2-(2-phenylethynyl)-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one |
|---|---|
| PubChem CID | 24778330 |
| Molecular Formula | C28H24N2O |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 9-tert-butyl-2-(2-phenylethynyl)-7,12-dihydro-5H-indolo[3,2-d][1]benzazepin-6-one |
| SMILES | CC(C)(C)c1ccc2[nH]c3c(c2c1)CC(=O)Nc1ccc(C#Cc2ccccc2)cc1-3 |
| InChI | InChI=1S/C28H24N2O/c1-28(2,3)20-12-14-24-21(16-20)22-17-26(31)29-25-13-11-19(15-23(25)27(22)30-24)10-9-18-7-5-4-6-8-18/h4-8,11-16,30H,17H2,1-3H3,(H,29,31) |
| InChIKey | NKKLVLUKQGATIB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|