C22H22O3 — CID 24778352
ethyl (6E)-5-hydroxy-2-methyl-4,7-diphenylhepta-2,3,6-trienoate (PubChem CID 24778352) has the molecular formula C22H22O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is ethyl (6E)-5-hydroxy-2-methyl-4,7-diphenylhepta-2,3,6-trienoate.
| Compound Name | ethyl (6E)-5-hydroxy-2-methyl-4,7-diphenylhepta-2,3,6-trienoate |
|---|---|
| PubChem CID | 24778352 |
| Molecular Formula | C22H22O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | ethyl (6E)-5-hydroxy-2-methyl-4,7-diphenylhepta-2,3,6-trienoate |
| SMILES | CCOC(=O)C(C)=C=C(c1ccccc1)C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H22O3/c1-3-25-22(24)17(2)16-20(19-12-8-5-9-13-19)21(23)15-14-18-10-6-4-7-11-18/h4-15,21,23H,3H2,1-2H3/b15-14+ |
| InChIKey | GIGKFRANNZZDGB-CCEZHUSRSA-N |
| XLogP | 4.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|