C28H56NO7P — CID 24779534
[(2S)-3-acetyloxy-2-[(Z)-octadec-7-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 24779534) has the molecular formula C28H56NO7P and a molecular weight of 549.73 g/mol. Its IUPAC name is [(2S)-3-acetyloxy-2-[(Z)-octadec-7-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2S)-3-acetyloxy-2-[(Z)-octadec-7-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 24779534 |
| Molecular Formula | C28H56NO7P |
| Molecular Weight | 549.73 g/mol |
| Exact Mass | 549.38 |
| IUPAC Name | [(2S)-3-acetyloxy-2-[(Z)-octadec-7-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCCCC/C=C\CCCCCCO[C@@H](COC(C)=O)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C28H56NO7P/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-33-28(25-34-27(2)30)26-36-37(31,32)35-24-22-29(3,4)5/h15-16,28H,6-14,17-26H2,1-5H3/b16-15-/t28-/m0/s1 |
| InChIKey | JQPICSFTFYNSJE-NMCSCQACSA-N |
| XLogP | 6.18 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.73 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|