C29H58NO6P — CID 24779432
[(2S)-2-[(Z)-octadec-7-enoxy]-3-[(Z)-prop-1-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 24779432) has the molecular formula C29H58NO6P and a molecular weight of 547.76 g/mol. Its IUPAC name is [(2S)-2-[(Z)-octadec-7-enoxy]-3-[(Z)-prop-1-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2S)-2-[(Z)-octadec-7-enoxy]-3-[(Z)-prop-1-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 24779432 |
| Molecular Formula | C29H58NO6P |
| Molecular Weight | 547.76 g/mol |
| Exact Mass | 547.40 |
| IUPAC Name | [(2S)-2-[(Z)-octadec-7-enoxy]-3-[(Z)-prop-1-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | C/C=C\OC[C@@H](COP(=O)([O-])OCC[N+](C)(C)C)OCCCCCC/C=C\CCCCCCCCCC |
| InChI | InChI=1S/C29H58NO6P/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25-34-29(27-33-24-7-2)28-36-37(31,32)35-26-23-30(3,4)5/h7,16-17,24,29H,6,8-15,18-23,25-28H2,1-5H3/b17-16-,24-7-/t29-/m0/s1 |
| InChIKey | QADGPFXFPSJKLN-HMHVWIFOSA-N |
| XLogP | 7.17 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.76 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|