C20H27F2N3O4S — CID 24784872
4-[(2S)-1,1-difluoropropan-2-yl]-N-[2-methoxy-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide (PubChem CID 24784872) has the molecular formula C20H27F2N3O4S and a molecular weight of 443.52 g/mol. Its IUPAC name is 4-[(2S)-1,1-difluoropropan-2-yl]-N-[2-methoxy-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide.
| Compound Name | 4-[(2S)-1,1-difluoropropan-2-yl]-N-[2-methoxy-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24784872 |
| Molecular Formula | C20H27F2N3O4S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 4-[(2S)-1,1-difluoropropan-2-yl]-N-[2-methoxy-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide |
| SMILES | CCCNCCOc1ccc(NS(=O)(=O)c2ccc([C@H](C)C(F)F)cc2)c(OC)n1 |
| InChI | InChI=1S/C20H27F2N3O4S/c1-4-11-23-12-13-29-18-10-9-17(20(24-18)28-3)25-30(26,27)16-7-5-15(6-8-16)14(2)19(21)22/h5-10,14,19,23,25H,4,11-13H2,1-3H3/t14-/m0/s1 |
| InChIKey | IGAKEMHBBVPMSS-AWEZNQCLSA-N |
| XLogP | 3.64 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|