C19H26FN3O4S — CID 24785114
4-(2-fluoroethoxy)-N-[2-methyl-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide (PubChem CID 24785114) has the molecular formula C19H26FN3O4S and a molecular weight of 411.50 g/mol. Its IUPAC name is 4-(2-fluoroethoxy)-N-[2-methyl-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide.
| Compound Name | 4-(2-fluoroethoxy)-N-[2-methyl-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24785114 |
| Molecular Formula | C19H26FN3O4S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-(2-fluoroethoxy)-N-[2-methyl-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide |
| SMILES | CCCNCCOc1ccc(NS(=O)(=O)c2ccc(OCCF)cc2)c(C)n1 |
| InChI | InChI=1S/C19H26FN3O4S/c1-3-11-21-12-14-27-19-9-8-18(15(2)22-19)23-28(24,25)17-6-4-16(5-7-17)26-13-10-20/h4-9,21,23H,3,10-14H2,1-2H3 |
| InChIKey | ALYDXBJNWFPMPK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|