C20H28FN3O4S — CID 66883107
4-[(2R)-1-fluoropropan-2-yl]-N-[2-methoxy-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide (PubChem CID 66883107) has the molecular formula C20H28FN3O4S and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-[(2R)-1-fluoropropan-2-yl]-N-[2-methoxy-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide.
| Compound Name | 4-[(2R)-1-fluoropropan-2-yl]-N-[2-methoxy-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 66883107 |
| Molecular Formula | C20H28FN3O4S |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 4-[(2R)-1-fluoropropan-2-yl]-N-[2-methoxy-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide |
| SMILES | CCCNCCOc1ccc(NS(=O)(=O)c2ccc([C@@H](C)CF)cc2)c(OC)n1 |
| InChI | InChI=1S/C20H28FN3O4S/c1-4-11-22-12-13-28-19-10-9-18(20(23-19)27-3)24-29(25,26)17-7-5-16(6-8-17)15(2)14-21/h5-10,15,22,24H,4,11-14H2,1-3H3/t15-/m0/s1 |
| InChIKey | FVTXKTONYQKHLF-HNNXBMFYSA-N |
| XLogP | 3.34 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|