C19H25F2N3O5S — CID 87189625
4-(2,2-difluoroethoxy)-N-[2-methoxy-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide (PubChem CID 87189625) has the molecular formula C19H25F2N3O5S and a molecular weight of 445.49 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-N-[2-methoxy-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide.
| Compound Name | 4-(2,2-difluoroethoxy)-N-[2-methoxy-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 87189625 |
| Molecular Formula | C19H25F2N3O5S |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-N-[2-methoxy-6-[2-(propylamino)ethoxy]-3-pyridinyl]benzenesulfonamide |
| SMILES | CCCNCCOc1ccc(NS(=O)(=O)c2ccc(OCC(F)F)cc2)c(OC)n1 |
| InChI | InChI=1S/C19H25F2N3O5S/c1-3-10-22-11-12-28-18-9-8-16(19(23-18)27-2)24-30(25,26)15-6-4-14(5-7-15)29-13-17(20)21/h4-9,17,22,24H,3,10-13H2,1-2H3 |
| InChIKey | NXLKNHMHIPBYMB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|