C19H26FN3O5S — CID 90690627
4-(2-fluoroethoxy)-N-[2-methoxy-6-[2-(propan-2-ylamino)ethoxy]-3-pyridinyl]benzenesulfonamide (PubChem CID 90690627) has the molecular formula C19H26FN3O5S and a molecular weight of 427.50 g/mol. Its IUPAC name is 4-(2-fluoroethoxy)-N-[2-methoxy-6-[2-(propan-2-ylamino)ethoxy]-3-pyridinyl]benzenesulfonamide.
| Compound Name | 4-(2-fluoroethoxy)-N-[2-methoxy-6-[2-(propan-2-ylamino)ethoxy]-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90690627 |
| Molecular Formula | C19H26FN3O5S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 4-(2-fluoroethoxy)-N-[2-methoxy-6-[2-(propan-2-ylamino)ethoxy]-3-pyridinyl]benzenesulfonamide |
| SMILES | COc1nc(OCCNC(C)C)ccc1NS(=O)(=O)c1ccc(OCCF)cc1 |
| InChI | InChI=1S/C19H26FN3O5S/c1-14(2)21-11-13-28-18-9-8-17(19(22-18)26-3)23-29(24,25)16-6-4-15(5-7-16)27-12-10-20/h4-9,14,21,23H,10-13H2,1-3H3 |
| InChIKey | VXPWGZHODBMJOT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|