C26H24ClIN4O2 — CID 24784970
1-benzyl-5-chloro-3-[(3-iodophenyl)methyl]-7-piperazin-1-ylquinazoline-2,4-dione (PubChem CID 24784970) has the molecular formula C26H24ClIN4O2 and a molecular weight of 586.86 g/mol. Its IUPAC name is 1-benzyl-5-chloro-3-[(3-iodophenyl)methyl]-7-piperazin-1-ylquinazoline-2,4-dione.
| Compound Name | 1-benzyl-5-chloro-3-[(3-iodophenyl)methyl]-7-piperazin-1-ylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 24784970 |
| Molecular Formula | C26H24ClIN4O2 |
| Molecular Weight | 586.86 g/mol |
| Exact Mass | 586.06 |
| IUPAC Name | 1-benzyl-5-chloro-3-[(3-iodophenyl)methyl]-7-piperazin-1-ylquinazoline-2,4-dione |
| SMILES | O=c1c2c(Cl)cc(N3CCNCC3)cc2n(Cc2ccccc2)c(=O)n1Cc1cccc(I)c1 |
| InChI | InChI=1S/C26H24ClIN4O2/c27-22-14-21(30-11-9-29-10-12-30)15-23-24(22)25(33)32(17-19-7-4-8-20(28)13-19)26(34)31(23)16-18-5-2-1-3-6-18/h1-8,13-15,29H,9-12,16-17H2 |
| InChIKey | IIUNACGCLVTZBC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 59.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.86 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|