C27H27ClN4O2 — CID 24785463
1-benzyl-7-chloro-3-(2-phenylethyl)-5-piperazin-1-ylquinazoline-2,4-dione (PubChem CID 24785463) has the molecular formula C27H27ClN4O2 and a molecular weight of 474.99 g/mol. Its IUPAC name is 1-benzyl-7-chloro-3-(2-phenylethyl)-5-piperazin-1-ylquinazoline-2,4-dione.
| Compound Name | 1-benzyl-7-chloro-3-(2-phenylethyl)-5-piperazin-1-ylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 24785463 |
| Molecular Formula | C27H27ClN4O2 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 1-benzyl-7-chloro-3-(2-phenylethyl)-5-piperazin-1-ylquinazoline-2,4-dione |
| SMILES | O=c1c2c(N3CCNCC3)cc(Cl)cc2n(Cc2ccccc2)c(=O)n1CCc1ccccc1 |
| InChI | InChI=1S/C27H27ClN4O2/c28-22-17-23(30-15-12-29-13-16-30)25-24(18-22)32(19-21-9-5-2-6-10-21)27(34)31(26(25)33)14-11-20-7-3-1-4-8-20/h1-10,17-18,29H,11-16,19H2 |
| InChIKey | WRTPUQNBGCJDJF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |