C27H26ClN3O2 — CID 91206212
1-benzyl-7-chloro-4-hydroxy-6-methyl-5-phenyl-3-piperazin-1-ylquinolin-2-one (PubChem CID 91206212) has the molecular formula C27H26ClN3O2 and a molecular weight of 459.98 g/mol. Its IUPAC name is 1-benzyl-7-chloro-4-hydroxy-6-methyl-5-phenyl-3-piperazin-1-ylquinolin-2-one.
| Compound Name | 1-benzyl-7-chloro-4-hydroxy-6-methyl-5-phenyl-3-piperazin-1-ylquinolin-2-one |
|---|---|
| PubChem CID | 91206212 |
| Molecular Formula | C27H26ClN3O2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 1-benzyl-7-chloro-4-hydroxy-6-methyl-5-phenyl-3-piperazin-1-ylquinolin-2-one |
| SMILES | Cc1c(Cl)cc2c(c(O)c(N3CCNCC3)c(=O)n2Cc2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C27H26ClN3O2/c1-18-21(28)16-22-24(23(18)20-10-6-3-7-11-20)26(32)25(30-14-12-29-13-15-30)27(33)31(22)17-19-8-4-2-5-9-19/h2-11,16,29,32H,12-15,17H2,1H3 |
| InChIKey | XVXXPRXPGMHZNF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |