C37H76O9Si3 — CID 24786308
methyl (1R,2R,4S,5S,6S,7R,8S)-5,6,8-trihydroxy-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undecane-8-carboxylate (PubChem CID 24786308) has the molecular formula C37H76O9Si3 and a molecular weight of 749.26 g/mol. Its IUPAC name is methyl (1R,2R,4S,5S,6S,7R,8S)-5,6,8-trihydroxy-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undecane-8-carboxylate.
| Compound Name | methyl (1R,2R,4S,5S,6S,7R,8S)-5,6,8-trihydroxy-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undecane-8-carboxylate |
|---|---|
| PubChem CID | 24786308 |
| Molecular Formula | C37H76O9Si3 |
| Molecular Weight | 749.26 g/mol |
| Exact Mass | 748.48 |
| IUPAC Name | methyl (1R,2R,4S,5S,6S,7R,8S)-5,6,8-trihydroxy-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undecane-8-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@](C)(O[Si](CC)(CC)CC)[C@H]2CC[C@@](O)(C(=O)OC)[C@H](O2)[C@H](O)[C@@]1(O)[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C37H76O9Si3/c1-16-47(17-2,18-3)45-31-24-35(14,46-48(19-4,20-5)21-6)30-22-23-36(40,34(39)42-15)33(44-30)32(38)37(31,41)29(13)25-43-49(26(7)8,27(9)10)28(11)12/h26-33,38,40-41H,16-25H2,1-15H3/t29-,30-,31+,32+,33-,35-,36+,37-/m1/s1 |
| InChIKey | ZJNIQLPWJQYMQD-WLSGVQNRSA-N |
| XLogP | 7.93 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.26 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|