C22H44O7Si2 — CID 10928880
ethyl (2S)-2-[(2R,3S,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-6-oxooxan-2-yl]-2-hydroxyacetate (PubChem CID 10928880) has the molecular formula C22H44O7Si2 and a molecular weight of 476.76 g/mol. Its IUPAC name is ethyl (2S)-2-[(2R,3S,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-6-oxooxan-2-yl]-2-hydroxyacetate.
| Compound Name | ethyl (2S)-2-[(2R,3S,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-6-oxooxan-2-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 10928880 |
| Molecular Formula | C22H44O7Si2 |
| Molecular Weight | 476.76 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | ethyl (2S)-2-[(2R,3S,4S,5R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methyl-6-oxooxan-2-yl]-2-hydroxyacetate |
| SMILES | CCOC(=O)[C@@H](O)[C@@H]1OC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C22H44O7Si2/c1-13-26-19(24)15(23)16-14(2)17(28-30(9,10)21(3,4)5)18(20(25)27-16)29-31(11,12)22(6,7)8/h14-18,23H,13H2,1-12H3/t14-,15-,16+,17-,18+/m0/s1 |
| InChIKey | FUSUEZQYVTYJDD-IECFSIQFSA-N |
| XLogP | 4.25 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.76 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|