C36H72O8Si3 — CID 24786429
(1S,4S,7R,8R,10S,11S,12R)-4,11-dihydroxy-8-methyl-8,10-bis(triethylsilyloxy)-11-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-2,13-dioxatricyclo[5.4.2.04,12]tridecan-3-one (PubChem CID 24786429) has the molecular formula C36H72O8Si3 and a molecular weight of 717.22 g/mol. Its IUPAC name is (1S,4S,7R,8R,10S,11S,12R)-4,11-dihydroxy-8-methyl-8,10-bis(triethylsilyloxy)-11-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-2,13-dioxatricyclo[5.4.2.04,12]tridecan-3-one.
| Compound Name | (1S,4S,7R,8R,10S,11S,12R)-4,11-dihydroxy-8-methyl-8,10-bis(triethylsilyloxy)-11-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-2,13-dioxatricyclo[5.4.2.04,12]tridecan-3-one |
|---|---|
| PubChem CID | 24786429 |
| Molecular Formula | C36H72O8Si3 |
| Molecular Weight | 717.22 g/mol |
| Exact Mass | 716.45 |
| IUPAC Name | (1S,4S,7R,8R,10S,11S,12R)-4,11-dihydroxy-8-methyl-8,10-bis(triethylsilyloxy)-11-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-2,13-dioxatricyclo[5.4.2.04,12]tridecan-3-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@](C)(O[Si](CC)(CC)CC)[C@H]2CC[C@@]3(O)C(=O)O[C@@H]([C@H]3O2)[C@@]1(O)[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H72O8Si3/c1-15-45(16-2,17-3)43-30-23-34(14,44-46(18-4,19-5)20-6)29-21-22-35(38)31(41-29)32(42-33(35)37)36(30,39)28(13)24-40-47(25(7)8,26(9)10)27(11)12/h25-32,38-39H,15-24H2,1-14H3/t28-,29-,30+,31-,32+,34-,35+,36-/m1/s1 |
| InChIKey | YBRLVDNVTKRYMN-IYJIBUMKSA-N |
| XLogP | 8.32 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.22 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|