C14H19NO4 — CID 24787389
(4aR,7R,7aR)-1-benzyl-4a-methoxy-4,6,7,7a-tetrahydro-3H-furo[3,2-c]oxazin-7-ol (PubChem CID 24787389) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (4aR,7R,7aR)-1-benzyl-4a-methoxy-4,6,7,7a-tetrahydro-3H-furo[3,2-c]oxazin-7-ol.
| Compound Name | (4aR,7R,7aR)-1-benzyl-4a-methoxy-4,6,7,7a-tetrahydro-3H-furo[3,2-c]oxazin-7-ol |
|---|---|
| PubChem CID | 24787389 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (4aR,7R,7aR)-1-benzyl-4a-methoxy-4,6,7,7a-tetrahydro-3H-furo[3,2-c]oxazin-7-ol |
| SMILES | CO[C@@]12CCON(Cc3ccccc3)[C@@H]1[C@@H](O)CO2 |
| InChI | InChI=1S/C14H19NO4/c1-17-14-7-8-19-15(13(14)12(16)10-18-14)9-11-5-3-2-4-6-11/h2-6,12-13,16H,7-10H2,1H3/t12-,13+,14+/m0/s1 |
| InChIKey | ZPGNKBFQLGAPBR-BFHYXJOUSA-N |
| XLogP | 0.93 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |