C36H74O9Si3 — CID 24788090
(1R,2R,4S,5S,6S,7R,8S)-5,6,8-trihydroxy-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undecane-8-carboxylic acid (PubChem CID 24788090) has the molecular formula C36H74O9Si3 and a molecular weight of 735.24 g/mol. Its IUPAC name is (1R,2R,4S,5S,6S,7R,8S)-5,6,8-trihydroxy-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undecane-8-carboxylic acid.
| Compound Name | (1R,2R,4S,5S,6S,7R,8S)-5,6,8-trihydroxy-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undecane-8-carboxylic acid |
|---|---|
| PubChem CID | 24788090 |
| Molecular Formula | C36H74O9Si3 |
| Molecular Weight | 735.24 g/mol |
| Exact Mass | 734.46 |
| IUPAC Name | (1R,2R,4S,5S,6S,7R,8S)-5,6,8-trihydroxy-2-methyl-2,4-bis(triethylsilyloxy)-5-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-11-oxabicyclo[5.3.1]undecane-8-carboxylic acid |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@](C)(O[Si](CC)(CC)CC)[C@H]2CC[C@@](O)(C(=O)O)[C@H](O2)[C@H](O)[C@@]1(O)[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H74O9Si3/c1-15-46(16-2,17-3)44-30-23-34(14,45-47(18-4,19-5)20-6)29-21-22-35(40,33(38)39)32(43-29)31(37)36(30,41)28(13)24-42-48(25(7)8,26(9)10)27(11)12/h25-32,37,40-41H,15-24H2,1-14H3,(H,38,39)/t28-,29-,30+,31+,32-,34-,35+,36-/m1/s1 |
| InChIKey | KMPXGFQWHFTJDK-PIVBJSOQSA-N |
| XLogP | 7.84 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.24 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|