C33H44O6SSi — CID 24788127
[(2S,3R,4S,5R)-3,5-bis[(4-methoxyphenyl)methoxy]-2-phenylsulfanyloxan-4-yl]oxy-triethylsilane (PubChem CID 24788127) has the molecular formula C33H44O6SSi and a molecular weight of 596.86 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-3,5-bis[(4-methoxyphenyl)methoxy]-2-phenylsulfanyloxan-4-yl]oxy-triethylsilane.
| Compound Name | [(2S,3R,4S,5R)-3,5-bis[(4-methoxyphenyl)methoxy]-2-phenylsulfanyloxan-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 24788127 |
| Molecular Formula | C33H44O6SSi |
| Molecular Weight | 596.86 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | [(2S,3R,4S,5R)-3,5-bis[(4-methoxyphenyl)methoxy]-2-phenylsulfanyloxan-4-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](OCc2ccc(OC)cc2)[C@H](Sc2ccccc2)OC[C@H]1OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C33H44O6SSi/c1-6-41(7-2,8-3)39-31-30(36-22-25-14-18-27(34-4)19-15-25)24-38-33(40-29-12-10-9-11-13-29)32(31)37-23-26-16-20-28(35-5)21-17-26/h9-21,30-33H,6-8,22-24H2,1-5H3/t30-,31+,32-,33+/m1/s1 |
| InChIKey | PFOVLDQBLXSWFA-LVVLYVGBSA-N |
| XLogP | 7.71 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.86 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|