C22H24F3NO5 — CID 24795815
(6aR)-6-propyl-2-(tritritiomethoxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;2,2,2-trifluoroacetic acid (PubChem CID 24795815) has the molecular formula C22H24F3NO5 and a molecular weight of 445.45 g/mol. Its IUPAC name is (6aR)-6-propyl-2-(tritritiomethoxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;2,2,2-trifluoroacetic acid.
| Compound Name | (6aR)-6-propyl-2-(tritritiomethoxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 24795815 |
| Molecular Formula | C22H24F3NO5 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (6aR)-6-propyl-2-(tritritiomethoxy)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[3H]C([3H])([3H])Oc1cc2c3c(c1)-c1c(ccc(O)c1O)C[C@H]3N(CCC)CC2 |
| InChI | InChI=1S/C20H23NO3.C2HF3O2/c1-3-7-21-8-6-13-9-14(24-2)11-15-18(13)16(21)10-12-4-5-17(22)20(23)19(12)15;3-2(4,5)1(6)7/h4-5,9,11,16,22-23H,3,6-8,10H2,1-2H3;(H,6,7)/t16-;/m1./s1/i2T3; |
| InChIKey | CCEBJGCPSPTLRX-VEJMJXNZSA-N |
| XLogP | 4.27 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|